C13H16BFeNO-6 — CID 16685926
2-cyclopenta-2,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine;cyclopentane;iron (PubChem CID 16685926) has the molecular formula C13H16BFeNO-6 and a molecular weight of 268.93 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine;cyclopentane;iron.
| Compound Name | 2-cyclopenta-2,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine;cyclopentane;iron |
|---|---|
| PubChem CID | 16685926 |
| Molecular Formula | C13H16BFeNO-6 |
| Molecular Weight | 268.93 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine;cyclopentane;iron |
| SMILES | CC1COB([c-]2cccc2)N1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C8H11BNO.C5H5.Fe/c1-7-6-11-9(10-7)8-4-2-3-5-8;1-2-4-5-3-1;/h2-5,7,10H,6H2,1H3;1-5H;/q-1;-5; |
| InChIKey | WECNMWQDJUQUDE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.93 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|