C10H8ClFN4O2 — CID 166859597
2-chloro-4-(2,6-dimethoxypyrimidin-4-yl)-5-fluoropyrimidine (PubChem CID 166859597) has the molecular formula C10H8ClFN4O2 and a molecular weight of 270.65 g/mol. Its IUPAC name is 2-chloro-4-(2,6-dimethoxypyrimidin-4-yl)-5-fluoropyrimidine.
| Compound Name | 2-chloro-4-(2,6-dimethoxypyrimidin-4-yl)-5-fluoropyrimidine |
|---|---|
| PubChem CID | 166859597 |
| Molecular Formula | C10H8ClFN4O2 |
| Molecular Weight | 270.65 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-chloro-4-(2,6-dimethoxypyrimidin-4-yl)-5-fluoropyrimidine |
| SMILES | COc1cc(-c2nc(Cl)ncc2F)nc(OC)n1 |
| InChI | InChI=1S/C10H8ClFN4O2/c1-17-7-3-6(14-10(15-7)18-2)8-5(12)4-13-9(11)16-8/h3-4H,1-2H3 |
| InChIKey | QYEJFEYSXFQMHN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.65 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |