C8H11FN4 — CID 166859713
(E)-1-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluorobut-2-en-1-imine (PubChem CID 166859713) has the molecular formula C8H11FN4 and a molecular weight of 182.20 g/mol. Its IUPAC name is (E)-1-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluorobut-2-en-1-imine.
| Compound Name | (E)-1-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluorobut-2-en-1-imine |
|---|---|
| PubChem CID | 166859713 |
| Molecular Formula | C8H11FN4 |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | (E)-1-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluorobut-2-en-1-imine |
| SMILES | [H]/N=C(C(\F)=C/C)/n1nc(C)nc1C |
| InChI | InChI=1S/C8H11FN4/c1-4-7(9)8(10)13-6(3)11-5(2)12-13/h4,10H,1-3H3/b7-4+,10-8+ |
| InChIKey | HVLDVUAIMYNAQP-DAAQNPAKSA-N |
| XLogP | 1.59 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|