C21H29F2N — CID 166860012
1-[(5E,7E)-8-fluoro-4-(4-fluorocyclohexa-1,3-dien-1-yl)deca-5,7,9-trienyl]piperidine (PubChem CID 166860012) has the molecular formula C21H29F2N and a molecular weight of 333.47 g/mol. Its IUPAC name is 1-[(5E,7E)-8-fluoro-4-(4-fluorocyclohexa-1,3-dien-1-yl)deca-5,7,9-trienyl]piperidine.
| Compound Name | 1-[(5E,7E)-8-fluoro-4-(4-fluorocyclohexa-1,3-dien-1-yl)deca-5,7,9-trienyl]piperidine |
|---|---|
| PubChem CID | 166860012 |
| Molecular Formula | C21H29F2N |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-[(5E,7E)-8-fluoro-4-(4-fluorocyclohexa-1,3-dien-1-yl)deca-5,7,9-trienyl]piperidine |
| SMILES | C=C/C(F)=C\C=C\C(CCCN1CCCCC1)C1=CC=C(F)CC1 |
| InChI | InChI=1S/C21H29F2N/c1-2-20(22)10-6-8-18(19-11-13-21(23)14-12-19)9-7-17-24-15-4-3-5-16-24/h2,6,8,10-11,13,18H,1,3-5,7,9,12,14-17H2/b8-6+,20-10+ |
| InChIKey | OHHUCTJSJFMCOZ-UWWCCNHXSA-N |
| XLogP | 6.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|