C14H17F3HgO4 — CID 16686221
[(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury (PubChem CID 16686221) has the molecular formula C14H17F3HgO4 and a molecular weight of 506.87 g/mol. Its IUPAC name is [(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury.
| Compound Name | [(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury |
|---|---|
| PubChem CID | 16686221 |
| Molecular Formula | C14H17F3HgO4 |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | [(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury |
| SMILES | CCCCC1=CC(=O)/C(=C\[Hg]OC(=O)C(F)(F)F)C1(C)OC |
| InChI | InChI=1S/C12H17O2.C2HF3O2.Hg/c1-5-6-7-10-8-11(13)9(2)12(10,3)14-4;3-2(4,5)1(6)7;/h2,8H,5-7H2,1,3-4H3;(H,6,7);/q;;+1/p-1 |
| InChIKey | CNWQUGBNJJOHDA-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|