About diethyl tributylstannyl phosphate
diethyl tributylstannyl phosphate (PubChem CID 16686248) has the molecular formula C16H37O4PSn
and a molecular weight of 443.15 g/mol. Its IUPAC name is diethyl tributylstannyl phosphate.
Molecular Properties
| Compound Name | diethyl tributylstannyl phosphate |
| PubChem CID | 16686248 |
| Molecular Formula | C16H37O4PSn |
| Molecular Weight | 443.15 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | diethyl tributylstannyl phosphate |
| SMILES | CCCC[Sn](CCCC)(CCCC)OP(=O)(OCC)OCC |
| InChI | InChI=1S/C4H11O4P.3C4H9.Sn/c1-3-7-9(5,6)8-4-2;3*1-3-4-2;/h3-4H2,1-2H3,(H,5,6);3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | BCEVUNVLYHUNIK-UHFFFAOYSA-M |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.15 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl tributylstannyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl tributylstannyl phosphate?
The IUPAC name of diethyl tributylstannyl phosphate (CID 16686248) is diethyl tributylstannyl phosphate.
What is the SMILES notation for diethyl tributylstannyl phosphate?
The canonical SMILES for diethyl tributylstannyl phosphate is CCCC[Sn](CCCC)(CCCC)OP(=O)(OCC)OCC.
What is the InChIKey of diethyl tributylstannyl phosphate?
The InChIKey is BCEVUNVLYHUNIK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H11O4P.3C4H9.Sn/c1-3-7-9(5,6)8-4-2;3*1-3-4-2;/h3-4H2,1-2H3,(H,5,6);3*1,3-4H2,2H3;/q;;;;+1/p-1.
What are the key properties of diethyl tributylstannyl phosphate?
diethyl tributylstannyl phosphate has a molecular weight of 443.15 g/mol, XLogP of 6.53, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl tributylstannyl phosphate is sourced from PubChem (CID 16686248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).