C15H25NO2 — CID 166863142
3-[(6E,8Z)-7-methoxyundeca-6,8,10-trien-3-yl]-1,3-oxazolidine (PubChem CID 166863142) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-[(6E,8Z)-7-methoxyundeca-6,8,10-trien-3-yl]-1,3-oxazolidine.
| Compound Name | 3-[(6E,8Z)-7-methoxyundeca-6,8,10-trien-3-yl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 166863142 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 3-[(6E,8Z)-7-methoxyundeca-6,8,10-trien-3-yl]-1,3-oxazolidine |
| SMILES | C=C/C=C\C(=C/CCC(CC)N1CCOC1)OC |
| InChI | InChI=1S/C15H25NO2/c1-4-6-9-15(17-3)10-7-8-14(5-2)16-11-12-18-13-16/h4,6,9-10,14H,1,5,7-8,11-13H2,2-3H3/b9-6-,15-10+ |
| InChIKey | RODUBLIOCJEWPV-SYFSHSHVSA-N |
| XLogP | 3.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|