C39H52N2O5 — CID 166864008
5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]-N-(5,6-dihydroxyhexyl)-N-ethylhexanamide (PubChem CID 166864008) has the molecular formula C39H52N2O5 and a molecular weight of 628.85 g/mol. Its IUPAC name is 5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]-N-(5,6-dihydroxyhexyl)-N-ethylhexanamide.
| Compound Name | 5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]-N-(5,6-dihydroxyhexyl)-N-ethylhexanamide |
|---|---|
| PubChem CID | 166864008 |
| Molecular Formula | C39H52N2O5 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.39 |
| IUPAC Name | 5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]-N-(5,6-dihydroxyhexyl)-N-ethylhexanamide |
| SMILES | CCN(CCCCC(O)CO)C(=O)CCCC(C)c1ccc(C)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C39H52N2O5/c1-4-41(23-8-7-11-32(43)26-42)38(44)14-9-10-28(2)30-16-15-29(3)31(24-30)27-45-39(20-21-39)36-25-40-22-19-34(36)35-12-5-6-13-37(35)46-33-17-18-33/h5-6,12-13,15-16,19,22,24-25,28,32-33,42-43H,4,7-11,14,17-18,20-21,23,26-27H2,1-3H3 |
| InChIKey | FFOMDLAABLROFA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|