About (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine
(2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine (PubChem CID 166864646) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine.
Molecular Properties
| Compound Name | (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine |
| PubChem CID | 166864646 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine |
| SMILES | CC1c2c(N)cccc2O[C@H]1C |
| InChI | InChI=1S/C10H13NO/c1-6-7(2)12-9-5-3-4-8(11)10(6)9/h3-7H,11H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | VOVHXYTVLUHWHO-MLWJPKLSSA-N |
| XLogP | 2.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine?
The IUPAC name of (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine (CID 166864646) is (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine.
What is the SMILES notation for (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine?
The canonical SMILES for (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine is CC1c2c(N)cccc2O[C@H]1C.
What is the InChIKey of (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine?
The InChIKey is VOVHXYTVLUHWHO-MLWJPKLSSA-N. The full InChI is InChI=1S/C10H13NO/c1-6-7(2)12-9-5-3-4-8(11)10(6)9/h3-7H,11H2,1-2H3/t6?,7-/m0/s1.
What are the key properties of (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine?
(2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine has a molecular weight of 163.22 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dimethyl-2,3-dihydro-1-benzofuran-4-amine is sourced from PubChem (CID 166864646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).