C16H25N — CID 166864652
(2E,5Z)-3-ethyl-N-(2-methylbutyl)-4-methylideneocta-2,5,7-trien-1-imine (PubChem CID 166864652) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (2E,5Z)-3-ethyl-N-(2-methylbutyl)-4-methylideneocta-2,5,7-trien-1-imine.
| Compound Name | (2E,5Z)-3-ethyl-N-(2-methylbutyl)-4-methylideneocta-2,5,7-trien-1-imine |
|---|---|
| PubChem CID | 166864652 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (2E,5Z)-3-ethyl-N-(2-methylbutyl)-4-methylideneocta-2,5,7-trien-1-imine |
| SMILES | C=C/C=C\C(=C)/C(=C/C=N/CC(C)CC)CC |
| InChI | InChI=1S/C16H25N/c1-6-9-10-15(5)16(8-3)11-12-17-13-14(4)7-2/h6,9-12,14H,1,5,7-8,13H2,2-4H3/b10-9-,16-11+,17-12+ |
| InChIKey | HXAWASKINJNPDL-BCBOQUFQSA-N |
| XLogP | 4.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|