C24H28F3NO — CID 166864768
(1E,5E)-2,10,12-trimethyl-6-[(3E)-5-methyl-4-(trifluoromethyl)hexa-1,3-dien-2-yl]-7,8-dihydro-3-benzazecin-1-ol (PubChem CID 166864768) has the molecular formula C24H28F3NO and a molecular weight of 403.49 g/mol. Its IUPAC name is (1E,5E)-2,10,12-trimethyl-6-[(3E)-5-methyl-4-(trifluoromethyl)hexa-1,3-dien-2-yl]-7,8-dihydro-3-benzazecin-1-ol.
| Compound Name | (1E,5E)-2,10,12-trimethyl-6-[(3E)-5-methyl-4-(trifluoromethyl)hexa-1,3-dien-2-yl]-7,8-dihydro-3-benzazecin-1-ol |
|---|---|
| PubChem CID | 166864768 |
| Molecular Formula | C24H28F3NO |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (1E,5E)-2,10,12-trimethyl-6-[(3E)-5-methyl-4-(trifluoromethyl)hexa-1,3-dien-2-yl]-7,8-dihydro-3-benzazecin-1-ol |
| SMILES | C=C(/C=C(\C(C)C)C(F)(F)F)/C1=C/C=N/C(C)=C(/O)c2c(C)cc(C)cc2CC1 |
| InChI | InChI=1S/C24H28F3NO/c1-14(2)21(24(25,26)27)13-16(4)19-7-8-20-12-15(3)11-17(5)22(20)23(29)18(6)28-10-9-19/h9-14,29H,4,7-8H2,1-3,5-6H3/b19-9+,21-13+,23-18+,28-10+ |
| InChIKey | HGAOXEPWXKWDPX-WCUDMQIMSA-N |
| XLogP | 7.19 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|