About 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine
1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine (PubChem CID 166864798) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine.
Molecular Properties
| Compound Name | 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine |
| PubChem CID | 166864798 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine |
| SMILES | CN1CC=CC2N=CC=CC21 |
| InChI | InChI=1S/C9H12N2/c1-11-7-3-4-8-9(11)5-2-6-10-8/h2-6,8-9H,7H2,1H3 |
| InChIKey | ZULNYBAIFWSPGG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine?
The IUPAC name of 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine (CID 166864798) is 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine.
What is the SMILES notation for 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine?
The canonical SMILES for 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine is CN1CC=CC2N=CC=CC21.
What is the InChIKey of 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine?
The InChIKey is ZULNYBAIFWSPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-11-7-3-4-8-9(11)5-2-6-10-8/h2-6,8-9H,7H2,1H3.
What are the key properties of 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine?
1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine has a molecular weight of 148.21 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4a,8a-dihydro-2H-1,5-naphthyridine is sourced from PubChem (CID 166864798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).