C9H14O — CID 16686487
(1S,2R,4R)-6-(deuteriomethylidene)bicyclo[2.2.2]octan-2-ol (PubChem CID 16686487) has the molecular formula C9H14O and a molecular weight of 139.22 g/mol. Its IUPAC name is (1S,2R,4R)-6-(deuteriomethylidene)bicyclo[2.2.2]octan-2-ol.
| Compound Name | (1S,2R,4R)-6-(deuteriomethylidene)bicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 16686487 |
| Molecular Formula | C9H14O |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (1S,2R,4R)-6-(deuteriomethylidene)bicyclo[2.2.2]octan-2-ol |
| SMILES | [2H]/C=C1\C[C@H]2CC[C@@H]1[C@H](O)C2 |
| InChI | InChI=1S/C9H14O/c1-6-4-7-2-3-8(6)9(10)5-7/h7-10H,1-5H2/t7-,8+,9-/m1/s1/i1D/b6-1+ |
| InChIKey | BXUWLPLZTUAUAN-ZAKUEFINSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|