C9H19N3 — CID 166864941
(E)-4-butan-2-yliminopent-2-ene-2,3-diamine (PubChem CID 166864941) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is (E)-4-butan-2-yliminopent-2-ene-2,3-diamine.
| Compound Name | (E)-4-butan-2-yliminopent-2-ene-2,3-diamine |
|---|---|
| PubChem CID | 166864941 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (E)-4-butan-2-yliminopent-2-ene-2,3-diamine |
| SMILES | CCC(C)/N=C(C)/C(N)=C(/C)N |
| InChI | InChI=1S/C9H19N3/c1-5-6(2)12-8(4)9(11)7(3)10/h6H,5,10-11H2,1-4H3/b9-7+,12-8+ |
| InChIKey | TWNQKCOTOHJQPB-BRVZEXMBSA-N |
| XLogP | 1.39 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|