About lithium tetrakis(tert-butylamino)alumanuide
lithium tetrakis(tert-butylamino)alumanuide (PubChem CID 16686495) has the molecular formula C16H40AlLiN4
and a molecular weight of 322.45 g/mol. Its IUPAC name is lithium tetrakis(tert-butylamino)alumanuide.
Molecular Properties
| Compound Name | lithium tetrakis(tert-butylamino)alumanuide |
| PubChem CID | 16686495 |
| Molecular Formula | C16H40AlLiN4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | lithium tetrakis(tert-butylamino)alumanuide |
| SMILES | CC(C)(C)N[Al-](NC(C)(C)C)(NC(C)(C)C)NC(C)(C)C.[Li+] |
| InChI | InChI=1S/4C4H10N.Al.Li/c4*1-4(2,3)5;;/h4*5H,1-3H3;;/q4*-1;+3;+1 |
| InChIKey | HXTJIJOIKKYEJU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium tetrakis(tert-butylamino)alumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium tetrakis(tert-butylamino)alumanuide?
The IUPAC name of lithium tetrakis(tert-butylamino)alumanuide (CID 16686495) is lithium tetrakis(tert-butylamino)alumanuide.
What is the SMILES notation for lithium tetrakis(tert-butylamino)alumanuide?
The canonical SMILES for lithium tetrakis(tert-butylamino)alumanuide is CC(C)(C)N[Al-](NC(C)(C)C)(NC(C)(C)C)NC(C)(C)C.[Li+].
What is the InChIKey of lithium tetrakis(tert-butylamino)alumanuide?
The InChIKey is HXTJIJOIKKYEJU-UHFFFAOYSA-N. The full InChI is InChI=1S/4C4H10N.Al.Li/c4*1-4(2,3)5;;/h4*5H,1-3H3;;/q4*-1;+3;+1.
What are the key properties of lithium tetrakis(tert-butylamino)alumanuide?
lithium tetrakis(tert-butylamino)alumanuide has a molecular weight of 322.45 g/mol, XLogP of -0.02, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium tetrakis(tert-butylamino)alumanuide is sourced from PubChem (CID 16686495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).