About 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile
6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile (PubChem CID 166864990) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile |
| PubChem CID | 166864990 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile |
| SMILES | CC1C=C(N)C(C#N)=CC1C#N |
| InChI | InChI=1S/C9H9N3/c1-6-2-9(12)8(5-11)3-7(6)4-10/h2-3,6-7H,12H2,1H3 |
| InChIKey | OPIAVVGHGYIRIM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile?
The IUPAC name of 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile (CID 166864990) is 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile.
What is the SMILES notation for 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile?
The canonical SMILES for 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile is CC1C=C(N)C(C#N)=CC1C#N.
What is the InChIKey of 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile?
The InChIKey is OPIAVVGHGYIRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-6-2-9(12)8(5-11)3-7(6)4-10/h2-3,6-7H,12H2,1H3.
What are the key properties of 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile?
6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile has a molecular weight of 159.19 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-methylcyclohexa-1,5-diene-1,3-dicarbonitrile is sourced from PubChem (CID 166864990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).