C20H31N — CID 166865012
1-(4,5-dimethylhept-2-en-4-yl)-6-[(2Z,4Z)-hexa-2,4-dienyl]-2H-pyridine (PubChem CID 166865012) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is 1-(4,5-dimethylhept-2-en-4-yl)-6-[(2Z,4Z)-hexa-2,4-dienyl]-2H-pyridine.
| Compound Name | 1-(4,5-dimethylhept-2-en-4-yl)-6-[(2Z,4Z)-hexa-2,4-dienyl]-2H-pyridine |
|---|---|
| PubChem CID | 166865012 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-(4,5-dimethylhept-2-en-4-yl)-6-[(2Z,4Z)-hexa-2,4-dienyl]-2H-pyridine |
| SMILES | CC=CC(C)(C(C)CC)N1CC=CC=C1C/C=C\C=C/C |
| InChI | InChI=1S/C20H31N/c1-6-9-10-11-14-19-15-12-13-17-21(19)20(5,16-7-2)18(4)8-3/h6-7,9-13,15-16,18H,8,14,17H2,1-5H3/b9-6-,11-10-,16-7? |
| InChIKey | HSPZHPRQIDXMAS-DLVUYECBSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|