C17H25NO — CID 166865030
8-cyclohexa-2,4-dien-1-yl-2,7-dimethyl-3,4,4a,7,8,8a-hexahydro-1H-isoquinolin-3-ol (PubChem CID 166865030) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 8-cyclohexa-2,4-dien-1-yl-2,7-dimethyl-3,4,4a,7,8,8a-hexahydro-1H-isoquinolin-3-ol.
| Compound Name | 8-cyclohexa-2,4-dien-1-yl-2,7-dimethyl-3,4,4a,7,8,8a-hexahydro-1H-isoquinolin-3-ol |
|---|---|
| PubChem CID | 166865030 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 8-cyclohexa-2,4-dien-1-yl-2,7-dimethyl-3,4,4a,7,8,8a-hexahydro-1H-isoquinolin-3-ol |
| SMILES | CC1C=CC2CC(O)N(C)CC2C1C1C=CC=CC1 |
| InChI | InChI=1S/C17H25NO/c1-12-8-9-14-10-16(19)18(2)11-15(14)17(12)13-6-4-3-5-7-13/h3-6,8-9,12-17,19H,7,10-11H2,1-2H3 |
| InChIKey | HGOOQAPRWUVVPU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|