About N-chloro-N'-ethylpent-4-enimidamide
N-chloro-N'-ethylpent-4-enimidamide (PubChem CID 166865049) has the molecular formula C7H13ClN2
and a molecular weight of 160.65 g/mol. Its IUPAC name is N-chloro-N'-ethylpent-4-enimidamide.
Molecular Properties
| Compound Name | N-chloro-N'-ethylpent-4-enimidamide |
| PubChem CID | 166865049 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | N-chloro-N'-ethylpent-4-enimidamide |
| SMILES | C=CCC/C(=N\CC)NCl |
| InChI | InChI=1S/C7H13ClN2/c1-3-5-6-7(10-8)9-4-2/h3H,1,4-6H2,2H3,(H,9,10) |
| InChIKey | TWRMTOLUNINJII-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-N'-ethylpent-4-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-N'-ethylpent-4-enimidamide?
The IUPAC name of N-chloro-N'-ethylpent-4-enimidamide (CID 166865049) is N-chloro-N'-ethylpent-4-enimidamide.
What is the SMILES notation for N-chloro-N'-ethylpent-4-enimidamide?
The canonical SMILES for N-chloro-N'-ethylpent-4-enimidamide is C=CCC/C(=N\CC)NCl.
What is the InChIKey of N-chloro-N'-ethylpent-4-enimidamide?
The InChIKey is TWRMTOLUNINJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClN2/c1-3-5-6-7(10-8)9-4-2/h3H,1,4-6H2,2H3,(H,9,10).
What are the key properties of N-chloro-N'-ethylpent-4-enimidamide?
N-chloro-N'-ethylpent-4-enimidamide has a molecular weight of 160.65 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-N'-ethylpent-4-enimidamide is sourced from PubChem (CID 166865049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).