C17H21F3HgO4 — CID 16686508
[(2S,5S)-2-hydroxy-5-(2-hydroxy-4-methylphenyl)-1,2,5-trimethylcyclopentyl]-(2,2,2-trifluoroacetyl)oxymercury (PubChem CID 16686508) has the molecular formula C17H21F3HgO4 and a molecular weight of 546.94 g/mol. Its IUPAC name is [(2S,5S)-2-hydroxy-5-(2-hydroxy-4-methylphenyl)-1,2,5-trimethylcyclopentyl]-(2,2,2-trifluoroacetyl)oxymercury.
| Compound Name | [(2S,5S)-2-hydroxy-5-(2-hydroxy-4-methylphenyl)-1,2,5-trimethylcyclopentyl]-(2,2,2-trifluoroacetyl)oxymercury |
|---|---|
| PubChem CID | 16686508 |
| Molecular Formula | C17H21F3HgO4 |
| Molecular Weight | 546.94 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | [(2S,5S)-2-hydroxy-5-(2-hydroxy-4-methylphenyl)-1,2,5-trimethylcyclopentyl]-(2,2,2-trifluoroacetyl)oxymercury |
| SMILES | Cc1ccc([C@]2(C)CC[C@](C)(O)C2(C)[Hg]OC(=O)C(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C15H21O2.C2HF3O2.Hg/c1-10-5-6-12(13(16)9-10)14(3)7-8-15(4,17)11(14)2;3-2(4,5)1(6)7;/h5-6,9,16-17H,7-8H2,1-4H3;(H,6,7);/q;;+1/p-1/t14-,15+;;/m1../s1 |
| InChIKey | SBLFAGPDGFKWRY-AMTWEWDESA-M |
| XLogP | 3.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.94 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|