About (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine
(1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine (PubChem CID 166865390) has the molecular formula C11H21F2N3
and a molecular weight of 233.31 g/mol. Its IUPAC name is (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine.
Molecular Properties
| Compound Name | (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine |
| PubChem CID | 166865390 |
| Molecular Formula | C11H21F2N3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine |
| SMILES | CC(C)C1CC/C(N)=C(/NN)C(F)(F)CC1 |
| InChI | InChI=1S/C11H21F2N3/c1-7(2)8-3-4-9(14)10(16-15)11(12,13)6-5-8/h7-8,16H,3-6,14-15H2,1-2H3/b10-9- |
| InChIKey | UUJKIODGLCQNPE-KTKRTIGZSA-N |
| XLogP | 2.10 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine?
The IUPAC name of (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine (CID 166865390) is (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine.
What is the SMILES notation for (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine?
The canonical SMILES for (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine is CC(C)C1CC/C(N)=C(/NN)C(F)(F)CC1.
What is the InChIKey of (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine?
The InChIKey is UUJKIODGLCQNPE-KTKRTIGZSA-N. The full InChI is InChI=1S/C11H21F2N3/c1-7(2)8-3-4-9(14)10(16-15)11(12,13)6-5-8/h7-8,16H,3-6,14-15H2,1-2H3/b10-9-.
What are the key properties of (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine?
(1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine has a molecular weight of 233.31 g/mol, XLogP of 2.10, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3,3-difluoro-2-hydrazinyl-6-propan-2-ylcycloocten-1-amine is sourced from PubChem (CID 166865390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).