C53H46N2 — CID 166865639
2'-[(Z)-3-aminoprop-1-enyl]-N-(9,9-dimethylfluoren-2-yl)-3'-methyl-N-(5-phenylcyclohepta-1,4,6-trien-1-yl)spiro[4a,9a-dihydrofluorene-9,1'-indene]-2-amine (PubChem CID 166865639) has the molecular formula C53H46N2 and a molecular weight of 710.97 g/mol. Its IUPAC name is 2'-[(Z)-3-aminoprop-1-enyl]-N-(9,9-dimethylfluoren-2-yl)-3'-methyl-N-(5-phenylcyclohepta-1,4,6-trien-1-yl)spiro[4a,9a-dihydrofluorene-9,1'-indene]-2-amine.
| Compound Name | 2'-[(Z)-3-aminoprop-1-enyl]-N-(9,9-dimethylfluoren-2-yl)-3'-methyl-N-(5-phenylcyclohepta-1,4,6-trien-1-yl)spiro[4a,9a-dihydrofluorene-9,1'-indene]-2-amine |
|---|---|
| PubChem CID | 166865639 |
| Molecular Formula | C53H46N2 |
| Molecular Weight | 710.97 g/mol |
| Exact Mass | 710.37 |
| IUPAC Name | 2'-[(Z)-3-aminoprop-1-enyl]-N-(9,9-dimethylfluoren-2-yl)-3'-methyl-N-(5-phenylcyclohepta-1,4,6-trien-1-yl)spiro[4a,9a-dihydrofluorene-9,1'-indene]-2-amine |
| SMILES | CC1=C(/C=C\CN)C2(c3ccccc31)c1ccccc1C1C=CC(N(C3=CCC=C(c4ccccc4)C=C3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)=CC12 |
| InChI | InChI=1S/C53H46N2/c1-35-41-19-7-11-23-48(41)53(46(35)25-14-32-54)49-24-12-9-21-43(49)45-31-29-40(34-51(45)53)55(38-18-13-17-37(26-27-38)36-15-5-4-6-16-36)39-28-30-44-42-20-8-10-22-47(42)52(2,3)50(44)33-39/h4-12,14-31,33-34,45,51H,13,32,54H2,1-3H3/b25-14- |
| InChIKey | DSWGFVWKICYTQN-QFEZKATASA-N |
| XLogP | 12.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.97 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |