C30H35N — CID 166865761
(2Z,5E,6E,8Z,10Z,13Z)-11-ethenyl-5-[(4Z,6Z)-nona-4,6-dien-8-ynylidene]-13-[(Z)-prop-1-enyl]hexadeca-2,6,8,10,13-pentaen-15-yn-4-amine (PubChem CID 166865761) has the molecular formula C30H35N and a molecular weight of 409.62 g/mol. Its IUPAC name is (2Z,5E,6E,8Z,10Z,13Z)-11-ethenyl-5-[(4Z,6Z)-nona-4,6-dien-8-ynylidene]-13-[(Z)-prop-1-enyl]hexadeca-2,6,8,10,13-pentaen-15-yn-4-amine.
| Compound Name | (2Z,5E,6E,8Z,10Z,13Z)-11-ethenyl-5-[(4Z,6Z)-nona-4,6-dien-8-ynylidene]-13-[(Z)-prop-1-enyl]hexadeca-2,6,8,10,13-pentaen-15-yn-4-amine |
|---|---|
| PubChem CID | 166865761 |
| Molecular Formula | C30H35N |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (2Z,5E,6E,8Z,10Z,13Z)-11-ethenyl-5-[(4Z,6Z)-nona-4,6-dien-8-ynylidene]-13-[(Z)-prop-1-enyl]hexadeca-2,6,8,10,13-pentaen-15-yn-4-amine |
| SMILES | C#C/C=C\C=C/CC/C=C(\C=C\C=C/C=C(\C=C)CC(/C=C\C)=C/C#C)C(N)/C=C\C |
| InChI | InChI=1S/C30H35N/c1-6-11-12-13-14-15-18-24-29(30(31)22-9-4)25-19-16-17-23-27(10-5)26-28(20-7-2)21-8-3/h1-2,8-14,16-17,19-25,30H,5,15,18,26,31H2,3-4H3/b12-11-,14-13-,17-16-,21-8-,22-9-,25-19+,27-23+,28-20+,29-24+ |
| InChIKey | MKMKHBLAOWMVOS-JORDXVQGSA-N |
| XLogP | 7.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|