About 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene
2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene (PubChem CID 166865845) has the molecular formula C15H18S
and a molecular weight of 230.38 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene.
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene |
| PubChem CID | 166865845 |
| Molecular Formula | C15H18S |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene |
| SMILES | C=C/C=C\C1=CC(CC)C2=CC=CCC2S1 |
| InChI | InChI=1S/C15H18S/c1-3-5-8-13-11-12(4-2)14-9-6-7-10-15(14)16-13/h3,5-9,11-12,15H,1,4,10H2,2H3/b8-5- |
| InChIKey | JRFSCUBCNIYZRD-YVMONPNESA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene (CID 166865845) is 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene.
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene is C=C/C=C\C1=CC(CC)C2=CC=CCC2S1.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene?
The InChIKey is JRFSCUBCNIYZRD-YVMONPNESA-N. The full InChI is InChI=1S/C15H18S/c1-3-5-8-13-11-12(4-2)14-9-6-7-10-15(14)16-13/h3,5-9,11-12,15H,1,4,10H2,2H3/b8-5-.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene?
2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene has a molecular weight of 230.38 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]-4-ethyl-8,8a-dihydro-4H-thiochromene is sourced from PubChem (CID 166865845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).