C20H28N2 — CID 166865898
1-[2-[(3E,6E,8Z)-4,6-dimethyldeca-1,3,6,8-tetraen-3-yl]cyclopenta-2,4-dien-1-yl]-1-[(Z)-prop-1-enyl]hydrazine (PubChem CID 166865898) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-[2-[(3E,6E,8Z)-4,6-dimethyldeca-1,3,6,8-tetraen-3-yl]cyclopenta-2,4-dien-1-yl]-1-[(Z)-prop-1-enyl]hydrazine.
| Compound Name | 1-[2-[(3E,6E,8Z)-4,6-dimethyldeca-1,3,6,8-tetraen-3-yl]cyclopenta-2,4-dien-1-yl]-1-[(Z)-prop-1-enyl]hydrazine |
|---|---|
| PubChem CID | 166865898 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-[2-[(3E,6E,8Z)-4,6-dimethyldeca-1,3,6,8-tetraen-3-yl]cyclopenta-2,4-dien-1-yl]-1-[(Z)-prop-1-enyl]hydrazine |
| SMILES | C=C/C(C1=CC=CC1N(N)/C=C\C)=C(/C)C/C(C)=C/C=C\C |
| InChI | InChI=1S/C20H28N2/c1-6-9-11-16(4)15-17(5)18(8-3)19-12-10-13-20(19)22(21)14-7-2/h6-14,20H,3,15,21H2,1-2,4-5H3/b9-6-,14-7-,16-11+,18-17+ |
| InChIKey | QBFKRSYUCVIRMY-SAWOLABLSA-N |
| XLogP | 4.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|