C26H32N6O3 — CID 166866389
N-[4-(4-aminobutoxy)-2-[hydroxy-(pyridin-2-ylamino)methyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)benzamide (PubChem CID 166866389) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[4-(4-aminobutoxy)-2-[hydroxy-(pyridin-2-ylamino)methyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)benzamide.
| Compound Name | N-[4-(4-aminobutoxy)-2-[hydroxy-(pyridin-2-ylamino)methyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 166866389 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-[4-(4-aminobutoxy)-2-[hydroxy-(pyridin-2-ylamino)methyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(OCCCCN)cc2C(O)Nc2ccccn2)cc1)N(C)C |
| InChI | InChI=1S/C26H32N6O3/c1-32(2)24(28)18-8-10-19(11-9-18)25(33)30-22-13-12-20(35-16-6-4-14-27)17-21(22)26(34)31-23-7-3-5-15-29-23/h3,5,7-13,15,17,26,28,34H,4,6,14,16,27H2,1-2H3,(H,29,31)(H,30,33)/b28-24- |
| InChIKey | KXYXQHNSMIJVTB-COOPMVRXSA-N |
| XLogP | 3.44 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|