C12H21N3OS — CID 166866781
(3aS,4R,6aR)-4-(5-aminohex-5-enyl)-3a-methyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one (PubChem CID 166866781) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-(5-aminohex-5-enyl)-3a-methyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4R,6aR)-4-(5-aminohex-5-enyl)-3a-methyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 166866781 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (3aS,4R,6aR)-4-(5-aminohex-5-enyl)-3a-methyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one |
| SMILES | C=C(N)CCCC[C@H]1SC[C@@H]2NC(=O)N[C@@]21C |
| InChI | InChI=1S/C12H21N3OS/c1-8(13)5-3-4-6-10-12(2)9(7-17-10)14-11(16)15-12/h9-10H,1,3-7,13H2,2H3,(H2,14,15,16)/t9-,10+,12-/m0/s1 |
| InChIKey | FDNUQRRMGCVSGI-UMNHJUIQSA-N |
| XLogP | 1.57 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|