About N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine
N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine (PubChem CID 166866931) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine |
| PubChem CID | 166866931 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine |
| SMILES | CNCC(CNC(C)C)CNC(C)C |
| InChI | InChI=1S/C11H27N3/c1-9(2)13-7-11(6-12-5)8-14-10(3)4/h9-14H,6-8H2,1-5H3 |
| InChIKey | LHYXORBQHKZPGG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine?
The IUPAC name of N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine (CID 166866931) is N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine.
What is the SMILES notation for N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine?
The canonical SMILES for N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine is CNCC(CNC(C)C)CNC(C)C.
What is the InChIKey of N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine?
The InChIKey is LHYXORBQHKZPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3/c1-9(2)13-7-11(6-12-5)8-14-10(3)4/h9-14H,6-8H2,1-5H3.
What are the key properties of N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine?
N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine has a molecular weight of 201.36 g/mol, XLogP of 0.82, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-propan-2-yl-2-[(propan-2-ylamino)methyl]propane-1,3-diamine is sourced from PubChem (CID 166866931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).