About 2-propoxypropylhydrazine
2-propoxypropylhydrazine (PubChem CID 166866965) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is 2-propoxypropylhydrazine.
Molecular Properties
| Compound Name | 2-propoxypropylhydrazine |
| PubChem CID | 166866965 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 2-propoxypropylhydrazine |
| SMILES | CCCOC(C)CNN |
| InChI | InChI=1S/C6H16N2O/c1-3-4-9-6(2)5-8-7/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | SNZHBPLXYXRRDA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxypropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxypropylhydrazine?
The IUPAC name of 2-propoxypropylhydrazine (CID 166866965) is 2-propoxypropylhydrazine.
What is the SMILES notation for 2-propoxypropylhydrazine?
The canonical SMILES for 2-propoxypropylhydrazine is CCCOC(C)CNN.
What is the InChIKey of 2-propoxypropylhydrazine?
The InChIKey is SNZHBPLXYXRRDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O/c1-3-4-9-6(2)5-8-7/h6,8H,3-5,7H2,1-2H3.
What are the key properties of 2-propoxypropylhydrazine?
2-propoxypropylhydrazine has a molecular weight of 132.21 g/mol, XLogP of 0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxypropylhydrazine is sourced from PubChem (CID 166866965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).