C18H19F17O2S — CID 166867217
4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2,2,4-trimethylpentanoic acid (PubChem CID 166867217) has the molecular formula C18H19F17O2S and a molecular weight of 622.38 g/mol. Its IUPAC name is 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2,2,4-trimethylpentanoic acid.
| Compound Name | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2,2,4-trimethylpentanoic acid |
|---|---|
| PubChem CID | 166867217 |
| Molecular Formula | C18H19F17O2S |
| Molecular Weight | 622.38 g/mol |
| Exact Mass | 622.08 |
| IUPAC Name | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2,2,4-trimethylpentanoic acid |
| SMILES | CC(C)(CC(C)(C)C(=O)O)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H19F17O2S/c1-9(2,8(36)37)7-10(3,4)38-6-5-11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h5-7H2,1-4H3,(H,36,37) |
| InChIKey | CKRPRGIBHSISKM-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.38 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|