About [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate
[2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate (PubChem CID 166867765) has the molecular formula C7H11IN2O5
and a molecular weight of 330.08 g/mol. Its IUPAC name is [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate.
Molecular Properties
| Compound Name | [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate |
| PubChem CID | 166867765 |
| Molecular Formula | C7H11IN2O5 |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate |
| SMILES | CNC(=O)OCC(C=O)COC(=O)NI |
| InChI | InChI=1S/C7H11IN2O5/c1-9-6(12)14-3-5(2-11)4-15-7(13)10-8/h2,5H,3-4H2,1H3,(H,9,12)(H,10,13) |
| InChIKey | NFFPYOPATKICAI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate?
The IUPAC name of [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate (CID 166867765) is [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate.
What is the SMILES notation for [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate?
The canonical SMILES for [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate is CNC(=O)OCC(C=O)COC(=O)NI.
What is the InChIKey of [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate?
The InChIKey is NFFPYOPATKICAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11IN2O5/c1-9-6(12)14-3-5(2-11)4-15-7(13)10-8/h2,5H,3-4H2,1H3,(H,9,12)(H,10,13).
What are the key properties of [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate?
[2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate has a molecular weight of 330.08 g/mol, XLogP of 0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-formyl-3-(methylcarbamoyloxy)propyl] N-iodocarbamate is sourced from PubChem (CID 166867765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).