C23H29N5 — CID 166867848
7-[(E)-2-(5-ethenyl-4,5-dihydro-1H-pyrazol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine (PubChem CID 166867848) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 7-[(E)-2-(5-ethenyl-4,5-dihydro-1H-pyrazol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine.
| Compound Name | 7-[(E)-2-(5-ethenyl-4,5-dihydro-1H-pyrazol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine |
|---|---|
| PubChem CID | 166867848 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 7-[(E)-2-(5-ethenyl-4,5-dihydro-1H-pyrazol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine |
| SMILES | C=CC1NN=CC1/C=C/C1NC2=C(C3=C1CCCC3)C1N=C(C)N(C)C1C=C2 |
| InChI | InChI=1S/C23H29N5/c1-4-18-15(13-24-27-18)9-10-19-16-7-5-6-8-17(16)22-20(26-19)11-12-21-23(22)25-14(2)28(21)3/h4,9-13,15,18-19,21,23,26-27H,1,5-8H2,2-3H3/b10-9+ |
| InChIKey | NPOKTNFZJBJPSE-MDZDMXLPSA-N |
| XLogP | 3.07 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|