C23H49N4O5P — CID 166868173
4-[[3-(4-ethylpiperazin-1-yl)-3,4-dimethoxybutyl]-propylphosphoryl]-2-piperazin-1-ylbutane-1,2-diol (PubChem CID 166868173) has the molecular formula C23H49N4O5P and a molecular weight of 492.64 g/mol. Its IUPAC name is 4-[[3-(4-ethylpiperazin-1-yl)-3,4-dimethoxybutyl]-propylphosphoryl]-2-piperazin-1-ylbutane-1,2-diol.
| Compound Name | 4-[[3-(4-ethylpiperazin-1-yl)-3,4-dimethoxybutyl]-propylphosphoryl]-2-piperazin-1-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 166868173 |
| Molecular Formula | C23H49N4O5P |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | 4-[[3-(4-ethylpiperazin-1-yl)-3,4-dimethoxybutyl]-propylphosphoryl]-2-piperazin-1-ylbutane-1,2-diol |
| SMILES | CCCP(=O)(CCC(O)(CO)N1CCNCC1)CCC(COC)(OC)N1CCN(CC)CC1 |
| InChI | InChI=1S/C23H49N4O5P/c1-5-17-33(30,18-7-22(29,20-28)26-11-9-24-10-12-26)19-8-23(32-4,21-31-3)27-15-13-25(6-2)14-16-27/h24,28-29H,5-21H2,1-4H3 |
| InChIKey | PBAHHAWGNUQZHH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|