C55H36N4 — CID 166868488
4-[3-[4-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline (PubChem CID 166868488) has the molecular formula C55H36N4 and a molecular weight of 752.92 g/mol. Its IUPAC name is 4-[3-[4-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline.
| Compound Name | 4-[3-[4-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 166868488 |
| Molecular Formula | C55H36N4 |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.29 |
| IUPAC Name | 4-[3-[4-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline |
| SMILES | Nc1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5cc(-c6ccccc6)c6c(c5-c5ccccc5)-c5cccc7cccc-6c57)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C55H36N4/c56-44-31-29-35(30-32-44)42-21-10-22-43(33-42)55-58-53(40-17-8-3-9-18-40)57-54(59-55)41-27-25-37(26-28-41)47-34-48(36-13-4-1-5-14-36)51-45-23-11-19-38-20-12-24-46(49(38)45)52(51)50(47)39-15-6-2-7-16-39/h1-34H,56H2 |
| InChIKey | ONDAVUWFRFUXMN-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|