C19H15NO3S — CID 166869084
8-(4-phenylphenyl)-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide (PubChem CID 166869084) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is 8-(4-phenylphenyl)-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide.
| Compound Name | 8-(4-phenylphenyl)-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide |
|---|---|
| PubChem CID | 166869084 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 8-(4-phenylphenyl)-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide |
| SMILES | O=S1(=O)NCc2cccc(-c3ccc(-c4ccccc4)cc3)c2O1 |
| InChI | InChI=1S/C19H15NO3S/c21-24(22)20-13-17-7-4-8-18(19(17)23-24)16-11-9-15(10-12-16)14-5-2-1-3-6-14/h1-12,20H,13H2 |
| InChIKey | JCUQNENJEVRKGB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |