C23H31ClN4O5 — CID 166869383
tert-butyl (11R)-6-chloro-4-(2-oxa-7-azaspiro[4.4]nonan-7-yl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-13-carboxylate (PubChem CID 166869383) has the molecular formula C23H31ClN4O5 and a molecular weight of 478.98 g/mol. Its IUPAC name is tert-butyl (11R)-6-chloro-4-(2-oxa-7-azaspiro[4.4]nonan-7-yl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-13-carboxylate.
| Compound Name | tert-butyl (11R)-6-chloro-4-(2-oxa-7-azaspiro[4.4]nonan-7-yl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-13-carboxylate |
|---|---|
| PubChem CID | 166869383 |
| Molecular Formula | C23H31ClN4O5 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | tert-butyl (11R)-6-chloro-4-(2-oxa-7-azaspiro[4.4]nonan-7-yl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=O)c3c(cc(Cl)nc3N3CCC4(CCOC4)C3)OC[C@H]2C1 |
| InChI | InChI=1S/C23H31ClN4O5/c1-22(2,3)33-21(30)26-7-8-28-15(11-26)12-32-16-10-17(24)25-19(18(16)20(28)29)27-6-4-23(13-27)5-9-31-14-23/h10,15H,4-9,11-14H2,1-3H3/t15-,23?/m1/s1 |
| InChIKey | ILDDBYJCEWLSPQ-NKTHEXPSSA-N |
| XLogP | 2.81 |
| TPSA | 84.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|