About N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine
N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine (PubChem CID 166869641) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine |
| PubChem CID | 166869641 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine |
| SMILES | COCCNC1CN(C)C(C)(C)C1 |
| InChI | InChI=1S/C10H22N2O/c1-10(2)7-9(8-12(10)3)11-5-6-13-4/h9,11H,5-8H2,1-4H3 |
| InChIKey | GVJWRPSTKYUVRW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine?
The IUPAC name of N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine (CID 166869641) is N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine.
What is the SMILES notation for N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine?
The canonical SMILES for N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine is COCCNC1CN(C)C(C)(C)C1.
What is the InChIKey of N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine?
The InChIKey is GVJWRPSTKYUVRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-10(2)7-9(8-12(10)3)11-5-6-13-4/h9,11H,5-8H2,1-4H3.
What are the key properties of N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine?
N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine has a molecular weight of 186.30 g/mol, XLogP of 0.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-1,5,5-trimethylpyrrolidin-3-amine is sourced from PubChem (CID 166869641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).