C22H19ClFN3O2 — CID 166870479
3-chloro-4-[(1S)-1-[(3-fluorobenzoyl)-(pyridin-3-ylmethyl)amino]ethyl]benzamide (PubChem CID 166870479) has the molecular formula C22H19ClFN3O2 and a molecular weight of 411.86 g/mol. Its IUPAC name is 3-chloro-4-[(1S)-1-[(3-fluorobenzoyl)-(pyridin-3-ylmethyl)amino]ethyl]benzamide.
| Compound Name | 3-chloro-4-[(1S)-1-[(3-fluorobenzoyl)-(pyridin-3-ylmethyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 166870479 |
| Molecular Formula | C22H19ClFN3O2 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 3-chloro-4-[(1S)-1-[(3-fluorobenzoyl)-(pyridin-3-ylmethyl)amino]ethyl]benzamide |
| SMILES | C[C@@H](c1ccc(C(N)=O)cc1Cl)N(Cc1cccnc1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H19ClFN3O2/c1-14(19-8-7-16(21(25)28)11-20(19)23)27(13-15-4-3-9-26-12-15)22(29)17-5-2-6-18(24)10-17/h2-12,14H,13H2,1H3,(H2,25,28)/t14-/m0/s1 |
| InChIKey | WKVURCBPNWUJBX-AWEZNQCLSA-N |
| XLogP | 4.38 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |