About 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine
2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine (PubChem CID 166870516) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine |
| PubChem CID | 166870516 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine |
| SMILES | CC1[C@H](OCCN(C)C)CCN1C |
| InChI | InChI=1S/C10H22N2O/c1-9-10(5-6-12(9)4)13-8-7-11(2)3/h9-10H,5-8H2,1-4H3/t9?,10-/m1/s1 |
| InChIKey | LASQUWCENAZRJS-QVDQXJPCSA-N |
| XLogP | 0.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine?
The IUPAC name of 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine (CID 166870516) is 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine?
The canonical SMILES for 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine is CC1[C@H](OCCN(C)C)CCN1C.
What is the InChIKey of 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine?
The InChIKey is LASQUWCENAZRJS-QVDQXJPCSA-N. The full InChI is InChI=1S/C10H22N2O/c1-9-10(5-6-12(9)4)13-8-7-11(2)3/h9-10H,5-8H2,1-4H3/t9?,10-/m1/s1.
What are the key properties of 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine?
2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine has a molecular weight of 186.30 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-1,2-dimethylpyrrolidin-3-yl]oxy-N,N-dimethylethanamine is sourced from PubChem (CID 166870516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).