C8H15F3N2 — CID 166870881
(2S,5S)-1,2,5-trimethyl-4-(trifluoromethyl)piperazine (PubChem CID 166870881) has the molecular formula C8H15F3N2 and a molecular weight of 196.22 g/mol. Its IUPAC name is (2S,5S)-1,2,5-trimethyl-4-(trifluoromethyl)piperazine.
| Compound Name | (2S,5S)-1,2,5-trimethyl-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 166870881 |
| Molecular Formula | C8H15F3N2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (2S,5S)-1,2,5-trimethyl-4-(trifluoromethyl)piperazine |
| SMILES | C[C@H]1CN(C(F)(F)F)[C@@H](C)CN1C |
| InChI | InChI=1S/C8H15F3N2/c1-6-5-13(8(9,10)11)7(2)4-12(6)3/h6-7H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | OSTHPCQJCJFVAJ-BQBZGAKWSA-N |
| XLogP | 1.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|