About (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine
(2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine (PubChem CID 166870882) has the molecular formula C9H15F3N2
and a molecular weight of 208.23 g/mol. Its IUPAC name is (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine.
Molecular Properties
| Compound Name | (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine |
| PubChem CID | 166870882 |
| Molecular Formula | C9H15F3N2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine |
| SMILES | C=C[C@H]1[C@@H](C)N(C(F)(F)F)CCN1C |
| InChI | InChI=1S/C9H15F3N2/c1-4-8-7(2)14(9(10,11)12)6-5-13(8)3/h4,7-8H,1,5-6H2,2-3H3/t7-,8+/m1/s1 |
| InChIKey | ZFIZBOSOJPCPFZ-SFYZADRCSA-N |
| XLogP | 1.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine?
The IUPAC name of (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine (CID 166870882) is (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine.
What is the SMILES notation for (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine?
The canonical SMILES for (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine is C=C[C@H]1[C@@H](C)N(C(F)(F)F)CCN1C.
What is the InChIKey of (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine?
The InChIKey is ZFIZBOSOJPCPFZ-SFYZADRCSA-N. The full InChI is InChI=1S/C9H15F3N2/c1-4-8-7(2)14(9(10,11)12)6-5-13(8)3/h4,7-8H,1,5-6H2,2-3H3/t7-,8+/m1/s1.
What are the key properties of (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine?
(2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine has a molecular weight of 208.23 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-ethenyl-1,3-dimethyl-4-(trifluoromethyl)piperazine is sourced from PubChem (CID 166870882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).