About N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide
N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide (PubChem CID 166870985) has the molecular formula C17H14N6OS
and a molecular weight of 350.41 g/mol. Its IUPAC name is N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide |
| PubChem CID | 166870985 |
| Molecular Formula | C17H14N6OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1nc2ccc(-c3ccccc3N)nc2s1 |
| InChI | InChI=1S/C17H14N6OS/c1-23-14(8-9-19-23)15(24)22-17-21-13-7-6-12(20-16(13)25-17)10-4-2-3-5-11(10)18/h2-9H,18H2,1H3,(H,21,22,24) |
| InChIKey | FGFHDXXUFBSARG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide?
The IUPAC name of N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide (CID 166870985) is N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide.
What is the SMILES notation for N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide?
The canonical SMILES for N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide is Cn1nccc1C(=O)Nc1nc2ccc(-c3ccccc3N)nc2s1.
What is the InChIKey of N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide?
The InChIKey is FGFHDXXUFBSARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N6OS/c1-23-14(8-9-19-23)15(24)22-17-21-13-7-6-12(20-16(13)25-17)10-4-2-3-5-11(10)18/h2-9H,18H2,1H3,(H,21,22,24).
What are the key properties of N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide?
N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide has a molecular weight of 350.41 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-methylpyrazole-3-carboxamide is sourced from PubChem (CID 166870985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).