About 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile
3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile (PubChem CID 166871037) has the molecular formula C10H13N3O3
and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile.
Molecular Properties
| Compound Name | 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile |
| PubChem CID | 166871037 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile |
| SMILES | N#CCCOC(COCC#N)COCC#N |
| InChI | InChI=1S/C10H13N3O3/c11-2-1-5-16-10(8-14-6-3-12)9-15-7-4-13/h10H,1,5-9H2 |
| InChIKey | QXRCDSRFCSNSKC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile?
The IUPAC name of 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile (CID 166871037) is 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile.
What is the SMILES notation for 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile?
The canonical SMILES for 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile is N#CCCOC(COCC#N)COCC#N.
What is the InChIKey of 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile?
The InChIKey is QXRCDSRFCSNSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3/c11-2-1-5-16-10(8-14-6-3-12)9-15-7-4-13/h10H,1,5-9H2.
What are the key properties of 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile?
3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile has a molecular weight of 223.23 g/mol, XLogP of 0.37, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-bis(cyanomethoxy)propan-2-yloxy]propanenitrile is sourced from PubChem (CID 166871037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).