About (2S,4R)-1,4-diamino-6-methylheptan-2-ol
(2S,4R)-1,4-diamino-6-methylheptan-2-ol (PubChem CID 166872257) has the molecular formula C8H20N2O
and a molecular weight of 160.26 g/mol. Its IUPAC name is (2S,4R)-1,4-diamino-6-methylheptan-2-ol.
Molecular Properties
| Compound Name | (2S,4R)-1,4-diamino-6-methylheptan-2-ol |
| PubChem CID | 166872257 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | (2S,4R)-1,4-diamino-6-methylheptan-2-ol |
| SMILES | CC(C)C[C@@H](N)C[C@H](O)CN |
| InChI | InChI=1S/C8H20N2O/c1-6(2)3-7(10)4-8(11)5-9/h6-8,11H,3-5,9-10H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | KVAZXCDAWNGOOS-SFYZADRCSA-N |
| XLogP | 0.07 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,4R)-1,4-diamino-6-methylheptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-1,4-diamino-6-methylheptan-2-ol?
The IUPAC name of (2S,4R)-1,4-diamino-6-methylheptan-2-ol (CID 166872257) is (2S,4R)-1,4-diamino-6-methylheptan-2-ol.
What is the SMILES notation for (2S,4R)-1,4-diamino-6-methylheptan-2-ol?
The canonical SMILES for (2S,4R)-1,4-diamino-6-methylheptan-2-ol is CC(C)C[C@@H](N)C[C@H](O)CN.
What is the InChIKey of (2S,4R)-1,4-diamino-6-methylheptan-2-ol?
The InChIKey is KVAZXCDAWNGOOS-SFYZADRCSA-N. The full InChI is InChI=1S/C8H20N2O/c1-6(2)3-7(10)4-8(11)5-9/h6-8,11H,3-5,9-10H2,1-2H3/t7-,8+/m1/s1.
What are the key properties of (2S,4R)-1,4-diamino-6-methylheptan-2-ol?
(2S,4R)-1,4-diamino-6-methylheptan-2-ol has a molecular weight of 160.26 g/mol, XLogP of 0.07, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-1,4-diamino-6-methylheptan-2-ol is sourced from PubChem (CID 166872257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).