About 3-phenylphosphanyl-N-trimethylsilylaniline
3-phenylphosphanyl-N-trimethylsilylaniline (PubChem CID 16687242) has the molecular formula C15H20NPSi
and a molecular weight of 273.39 g/mol. Its IUPAC name is 3-phenylphosphanyl-N-trimethylsilylaniline.
Molecular Properties
| Compound Name | 3-phenylphosphanyl-N-trimethylsilylaniline |
| PubChem CID | 16687242 |
| Molecular Formula | C15H20NPSi |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-phenylphosphanyl-N-trimethylsilylaniline |
| SMILES | C[Si](C)(C)Nc1cccc(Pc2ccccc2)c1 |
| InChI | InChI=1S/C15H20NPSi/c1-18(2,3)16-13-8-7-11-15(12-13)17-14-9-5-4-6-10-14/h4-12,16-17H,1-3H3 |
| InChIKey | DYDFIMAKVWJLTD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylphosphanyl-N-trimethylsilylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylphosphanyl-N-trimethylsilylaniline?
The IUPAC name of 3-phenylphosphanyl-N-trimethylsilylaniline (CID 16687242) is 3-phenylphosphanyl-N-trimethylsilylaniline.
What is the SMILES notation for 3-phenylphosphanyl-N-trimethylsilylaniline?
The canonical SMILES for 3-phenylphosphanyl-N-trimethylsilylaniline is C[Si](C)(C)Nc1cccc(Pc2ccccc2)c1.
What is the InChIKey of 3-phenylphosphanyl-N-trimethylsilylaniline?
The InChIKey is DYDFIMAKVWJLTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20NPSi/c1-18(2,3)16-13-8-7-11-15(12-13)17-14-9-5-4-6-10-14/h4-12,16-17H,1-3H3.
What are the key properties of 3-phenylphosphanyl-N-trimethylsilylaniline?
3-phenylphosphanyl-N-trimethylsilylaniline has a molecular weight of 273.39 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylphosphanyl-N-trimethylsilylaniline is sourced from PubChem (CID 16687242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).