About [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate
[acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate (PubChem CID 16687251) has the molecular formula C25H27O4Sb
and a molecular weight of 513.25 g/mol. Its IUPAC name is [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate.
Molecular Properties
| Compound Name | [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate |
| PubChem CID | 16687251 |
| Molecular Formula | C25H27O4Sb |
| Molecular Weight | 513.25 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate |
| SMILES | CC(=O)O[Sb](OC(C)=O)(c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/3C7H7.2C2H4O2.Sb/c3*1-7-5-3-2-4-6-7;2*1-2(3)4;/h3*3-6H,1H3;2*1H3,(H,3,4);/q;;;;;+2/p-2 |
| InChIKey | JIFLSIWFCCFZCQ-UHFFFAOYSA-L |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate?
The IUPAC name of [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate (CID 16687251) is [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate.
What is the SMILES notation for [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate?
The canonical SMILES for [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate is CC(=O)O[Sb](OC(C)=O)(c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1.
What is the InChIKey of [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate?
The InChIKey is JIFLSIWFCCFZCQ-UHFFFAOYSA-L. The full InChI is InChI=1S/3C7H7.2C2H4O2.Sb/c3*1-7-5-3-2-4-6-7;2*1-2(3)4;/h3*3-6H,1H3;2*1H3,(H,3,4);/q;;;;;+2/p-2.
What are the key properties of [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate?
[acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate has a molecular weight of 513.25 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy-tris(4-methylphenyl)-λ5-stibanyl] acetate is sourced from PubChem (CID 16687251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).