About sulfanyl 2-(2-methylpropoxy)benzoate
sulfanyl 2-(2-methylpropoxy)benzoate (PubChem CID 166873129) has the molecular formula C11H14O3S
and a molecular weight of 226.30 g/mol. Its IUPAC name is sulfanyl 2-(2-methylpropoxy)benzoate.
Molecular Properties
| Compound Name | sulfanyl 2-(2-methylpropoxy)benzoate |
| PubChem CID | 166873129 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | sulfanyl 2-(2-methylpropoxy)benzoate |
| SMILES | CC(C)COc1ccccc1C(=O)OS |
| InChI | InChI=1S/C11H14O3S/c1-8(2)7-13-10-6-4-3-5-9(10)11(12)14-15/h3-6,8,15H,7H2,1-2H3 |
| InChIKey | FEMUAXYAWFHDDC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl 2-(2-methylpropoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl 2-(2-methylpropoxy)benzoate?
The IUPAC name of sulfanyl 2-(2-methylpropoxy)benzoate (CID 166873129) is sulfanyl 2-(2-methylpropoxy)benzoate.
What is the SMILES notation for sulfanyl 2-(2-methylpropoxy)benzoate?
The canonical SMILES for sulfanyl 2-(2-methylpropoxy)benzoate is CC(C)COc1ccccc1C(=O)OS.
What is the InChIKey of sulfanyl 2-(2-methylpropoxy)benzoate?
The InChIKey is FEMUAXYAWFHDDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S/c1-8(2)7-13-10-6-4-3-5-9(10)11(12)14-15/h3-6,8,15H,7H2,1-2H3.
What are the key properties of sulfanyl 2-(2-methylpropoxy)benzoate?
sulfanyl 2-(2-methylpropoxy)benzoate has a molecular weight of 226.30 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl 2-(2-methylpropoxy)benzoate is sourced from PubChem (CID 166873129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).