C25H34N2O4 — CID 166873623
tert-butyl 4-[(dibenzylamino)methyl]-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 166873623) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is tert-butyl 4-[(dibenzylamino)methyl]-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(dibenzylamino)methyl]-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166873623 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | tert-butyl 4-[(dibenzylamino)methyl]-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(CN(Cc2ccccc2)Cc2ccccc2)CC1CO |
| InChI | InChI=1S/C25H34N2O4/c1-24(2,3)31-23(29)27-19-25(30,14-22(27)17-28)18-26(15-20-10-6-4-7-11-20)16-21-12-8-5-9-13-21/h4-13,22,28,30H,14-19H2,1-3H3 |
| InChIKey | WXMHWTSSEGHQOO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |