C14H24N2 — CID 166873985
1-N'-[(3E,5Z)-3-methylocta-3,5,7-trienyl]-1-N-propylethene-1,1-diamine (PubChem CID 166873985) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-N'-[(3E,5Z)-3-methylocta-3,5,7-trienyl]-1-N-propylethene-1,1-diamine.
| Compound Name | 1-N'-[(3E,5Z)-3-methylocta-3,5,7-trienyl]-1-N-propylethene-1,1-diamine |
|---|---|
| PubChem CID | 166873985 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-N'-[(3E,5Z)-3-methylocta-3,5,7-trienyl]-1-N-propylethene-1,1-diamine |
| SMILES | C=C/C=C\C=C(/C)CCNC(=C)NCCC |
| InChI | InChI=1S/C14H24N2/c1-5-7-8-9-13(3)10-12-16-14(4)15-11-6-2/h5,7-9,15-16H,1,4,6,10-12H2,2-3H3/b8-7-,13-9+ |
| InChIKey | OUODBEYQXJSXOJ-XTYDYKDCSA-N |
| XLogP | 3.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|