About 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine
1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine (PubChem CID 16687406) has the molecular formula C29H36AlNO2
and a molecular weight of 457.59 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine.
Molecular Properties
| Compound Name | 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine |
| PubChem CID | 16687406 |
| Molecular Formula | C29H36AlNO2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine |
| SMILES | C[Al](C)Oc1c(/C=N/c2ccccc2Oc2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H31NO2.2CH3.Al/c1-26(2,3)20-16-19(25(29)22(17-20)27(4,5)6)18-28-23-14-10-11-15-24(23)30-21-12-8-7-9-13-21;;;/h7-18,29H,1-6H3;2*1H3;/q;;;+1/p-1/b28-18+;;; |
| InChIKey | KNOAJTOJIZJPQM-SPFPQBDISA-M |
| XLogP | 8.45 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine?
The IUPAC name of 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine (CID 16687406) is 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine.
What is the SMILES notation for 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine?
The canonical SMILES for 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine is C[Al](C)Oc1c(/C=N/c2ccccc2Oc2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine?
The InChIKey is KNOAJTOJIZJPQM-SPFPQBDISA-M. The full InChI is InChI=1S/C27H31NO2.2CH3.Al/c1-26(2,3)20-16-19(25(29)22(17-20)27(4,5)6)18-28-23-14-10-11-15-24(23)30-21-12-8-7-9-13-21;;;/h7-18,29H,1-6H3;2*1H3;/q;;;+1/p-1/b28-18+;;;.
What are the key properties of 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine?
1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine has a molecular weight of 457.59 g/mol, XLogP of 8.45, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-(2-phenoxyphenyl)methanimine is sourced from PubChem (CID 16687406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).